C24H32N6O2 — CID 51625692
1-benzyl-4-[(S)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 51625692) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-benzyl-4-[(S)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-benzyl-4-[(S)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 51625692 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-benzyl-4-[(S)-(4-ethoxyphenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | CCOc1ccc([C@@H](c2nnnn2CCOC)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-3-32-22-11-9-21(10-12-22)23(24-25-26-27-30(24)17-18-31-2)29-15-13-28(14-16-29)19-20-7-5-4-6-8-20/h4-12,23H,3,13-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | OGRAYXBEHBXDNY-QHCPKHFHSA-N |
| XLogP | 2.63 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |