C26H36N6O — CID 51625627
1-benzyl-4-[(R)-(4-ethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperazine (PubChem CID 51625627) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is 1-benzyl-4-[(R)-(4-ethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-benzyl-4-[(R)-(4-ethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 51625627 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 1-benzyl-4-[(R)-(4-ethoxyphenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperazine |
| SMILES | CCOc1ccc([C@@H](c2nnnn2C(C)(C)CC)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H36N6O/c1-5-26(3,4)32-25(27-28-29-32)24(22-12-14-23(15-13-22)33-6-2)31-18-16-30(17-19-31)20-21-10-8-7-9-11-21/h7-15,24H,5-6,16-20H2,1-4H3/t24-/m0/s1 |
| InChIKey | BAPKYGCKLHBBHO-DEOSSOPVSA-N |
| XLogP | 4.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |