C27H31ClN6O — CID 171668386
1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine;hydrochloride (PubChem CID 171668386) has the molecular formula C27H31ClN6O and a molecular weight of 491.04 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine;hydrochloride.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668386 |
| Molecular Formula | C27H31ClN6O |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine;hydrochloride |
| SMILES | CCOc1ccc(C(c2nnnn2Cc2ccccc2)N2CCN(c3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C27H30N6O.ClH/c1-2-34-25-15-13-23(14-16-25)26(27-28-29-30-33(27)21-22-9-5-3-6-10-22)32-19-17-31(18-20-32)24-11-7-4-8-12-24;/h3-16,26H,2,17-21H2,1H3;1H |
| InChIKey | APIQNIDHVWKVBI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |