C27H36N6O — CID 1446271
1-[(S)-(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine (PubChem CID 1446271) has the molecular formula C27H36N6O and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-[(S)-(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 1446271 |
| Molecular Formula | C27H36N6O |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine |
| SMILES | CCOc1ccc([C@@H](c2nnnn2Cc2ccccc2)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C27H36N6O/c1-2-34-25-15-13-23(14-16-25)26(27-28-29-30-33(27)21-22-9-5-3-6-10-22)32-19-17-31(18-20-32)24-11-7-4-8-12-24/h3,5-6,9-10,13-16,24,26H,2,4,7-8,11-12,17-21H2,1H3/t26-/m0/s1 |
| InChIKey | XSUQSPYCRAIBMP-SANMLTNESA-N |
| XLogP | 4.16 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |