C24H38N6O — CID 1443976
1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine (PubChem CID 1443976) has the molecular formula C24H38N6O and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 1443976 |
| Molecular Formula | C24H38N6O |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-cyclohexylpiperazine |
| SMILES | CCOc1ccc([C@H](c2nnnn2C(C)(C)C)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H38N6O/c1-5-31-21-13-11-19(12-14-21)22(23-25-26-27-30(23)24(2,3)4)29-17-15-28(16-18-29)20-9-7-6-8-10-20/h11-14,20,22H,5-10,15-18H2,1-4H3/t22-/m1/s1 |
| InChIKey | XAQTVAUQNVZISQ-JOCHJYFZSA-N |
| XLogP | 3.87 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |