C19H30N6O — CID 1443946
1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-ethylpiperazine (PubChem CID 1443946) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-ethylpiperazine.
| Compound Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 1443946 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN([C@H](c2ccc(OC)cc2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H30N6O/c1-6-23-11-13-24(14-12-23)17(15-7-9-16(26-5)10-8-15)18-20-21-22-25(18)19(2,3)4/h7-10,17H,6,11-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | BKSTVQSJTNRDOX-QGZVFWFLSA-N |
| XLogP | 2.16 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |