C18H27ClN6 — CID 3209015
1-[(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-ethylpiperazine (PubChem CID 3209015) has the molecular formula C18H27ClN6 and a molecular weight of 362.91 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-ethylpiperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 3209015 |
| Molecular Formula | C18H27ClN6 |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(C(c2ccccc2Cl)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H27ClN6/c1-5-23-10-12-24(13-11-23)16(14-8-6-7-9-15(14)19)17-20-21-22-25(17)18(2,3)4/h6-9,16H,5,10-13H2,1-4H3 |
| InChIKey | RIXXZWFJEFPDMH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |