C21H29N7 — CID 43811824
6-[(1-tert-butyltetrazol-5-yl)-(4-ethylpiperazin-1-yl)methyl]quinoline (PubChem CID 43811824) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 6-[(1-tert-butyltetrazol-5-yl)-(4-ethylpiperazin-1-yl)methyl]quinoline.
| Compound Name | 6-[(1-tert-butyltetrazol-5-yl)-(4-ethylpiperazin-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 43811824 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 6-[(1-tert-butyltetrazol-5-yl)-(4-ethylpiperazin-1-yl)methyl]quinoline |
| SMILES | CCN1CCN(C(c2ccc3ncccc3c2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H29N7/c1-5-26-11-13-27(14-12-26)19(20-23-24-25-28(20)21(2,3)4)17-8-9-18-16(15-17)7-6-10-22-18/h6-10,15,19H,5,11-14H2,1-4H3 |
| InChIKey | JDQZGOHVRIZVOS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |