C26H31N7 — CID 3193630
6-[(4-benzylpiperazin-1-yl)-(1-tert-butyltetrazol-5-yl)methyl]quinoline (PubChem CID 3193630) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 6-[(4-benzylpiperazin-1-yl)-(1-tert-butyltetrazol-5-yl)methyl]quinoline.
| Compound Name | 6-[(4-benzylpiperazin-1-yl)-(1-tert-butyltetrazol-5-yl)methyl]quinoline |
|---|---|
| PubChem CID | 3193630 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 6-[(4-benzylpiperazin-1-yl)-(1-tert-butyltetrazol-5-yl)methyl]quinoline |
| SMILES | CC(C)(C)n1nnnc1C(c1ccc2ncccc2c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N7/c1-26(2,3)33-25(28-29-30-33)24(22-11-12-23-21(18-22)10-7-13-27-23)32-16-14-31(15-17-32)19-20-8-5-4-6-9-20/h4-13,18,24H,14-17,19H2,1-3H3 |
| InChIKey | RNKWFQMHBVCLTE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |