C21H29ClN6S — CID 6603093
1-benzyl-4-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine;hydrochloride (PubChem CID 6603093) has the molecular formula C21H29ClN6S and a molecular weight of 433.03 g/mol. Its IUPAC name is 1-benzyl-4-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine;hydrochloride.
| Compound Name | 1-benzyl-4-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 6603093 |
| Molecular Formula | C21H29ClN6S |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-benzyl-4-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine;hydrochloride |
| SMILES | CC(C)(C)n1nnnc1C(c1cccs1)N1CCN(Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C21H28N6S.ClH/c1-21(2,3)27-20(22-23-24-27)19(18-10-7-15-28-18)26-13-11-25(12-14-26)16-17-8-5-4-6-9-17;/h4-10,15,19H,11-14,16H2,1-3H3;1H |
| InChIKey | JALHSCNSRQJSPS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |