C23H31N5S — CID 1431025
4-benzyl-1-[(R)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine (PubChem CID 1431025) has the molecular formula C23H31N5S and a molecular weight of 409.60 g/mol. Its IUPAC name is 4-benzyl-1-[(R)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine.
| Compound Name | 4-benzyl-1-[(R)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine |
|---|---|
| PubChem CID | 1431025 |
| Molecular Formula | C23H31N5S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 4-benzyl-1-[(R)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine |
| SMILES | CCC(C)(C)n1nnnc1[C@@H](c1cccs1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N5S/c1-4-23(2,3)28-22(24-25-26-28)21(20-11-8-16-29-20)27-14-12-19(13-15-27)17-18-9-6-5-7-10-18/h5-11,16,19,21H,4,12-15,17H2,1-3H3/t21-/m1/s1 |
| InChIKey | BBOGMAUAIWZMEI-OAQYLSRUSA-N |
| XLogP | 4.92 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |