C22H35N5 — CID 1430991
4-benzyl-1-[(1S)-2-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]propyl]piperidine (PubChem CID 1430991) has the molecular formula C22H35N5 and a molecular weight of 369.56 g/mol. Its IUPAC name is 4-benzyl-1-[(1S)-2-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]propyl]piperidine.
| Compound Name | 4-benzyl-1-[(1S)-2-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]propyl]piperidine |
|---|---|
| PubChem CID | 1430991 |
| Molecular Formula | C22H35N5 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 4-benzyl-1-[(1S)-2-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]propyl]piperidine |
| SMILES | CCC(C)(C)n1nnnc1[C@H](C(C)C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N5/c1-6-22(4,5)27-21(23-24-25-27)20(17(2)3)26-14-12-19(13-15-26)16-18-10-8-7-9-11-18/h7-11,17,19-20H,6,12-16H2,1-5H3/t20-/m0/s1 |
| InChIKey | JWNNXUBXAUBATN-FQEVSTJZSA-N |
| XLogP | 4.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |