C21H33N5 — CID 1428697
4-benzyl-1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]piperidine (PubChem CID 1428697) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is 4-benzyl-1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]piperidine.
| Compound Name | 4-benzyl-1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]piperidine |
|---|---|
| PubChem CID | 1428697 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 4-benzyl-1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]piperidine |
| SMILES | CC(C)[C@@H](c1nnnn1C(C)(C)C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N5/c1-16(2)19(20-22-23-24-26(20)21(3,4)5)25-13-11-18(12-14-25)15-17-9-7-6-8-10-17/h6-10,16,18-19H,11-15H2,1-5H3/t19-/m0/s1 |
| InChIKey | PCSBZJUCMCGNBW-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |