C20H32N6O — CID 1443747
1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 1443747) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1443747 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN([C@H](c2nnnn2C(C)(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C20H32N6O/c1-15(2)18(19-21-22-23-26(19)20(3,4)5)25-13-11-24(12-14-25)16-9-7-8-10-17(16)27-6/h7-10,15,18H,11-14H2,1-6H3/t18-/m0/s1 |
| InChIKey | KHXMLJHOTOFKBF-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |