C18H28ClN5 — CID 6603424
1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidine;hydrochloride (PubChem CID 6603424) has the molecular formula C18H28ClN5 and a molecular weight of 349.91 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidine;hydrochloride.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 6603424 |
| Molecular Formula | C18H28ClN5 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidine;hydrochloride |
| SMILES | CC1CCN(C(c2ccccc2)c2nnnn2C(C)(C)C)CC1.Cl |
| InChI | InChI=1S/C18H27N5.ClH/c1-14-10-12-22(13-11-14)16(15-8-6-5-7-9-15)17-19-20-21-23(17)18(2,3)4;/h5-9,14,16H,10-13H2,1-4H3;1H |
| InChIKey | WXBAYXDCFMKZBC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |