C21H24FN5 — CID 1433407
1-[(S)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-phenylmethyl]-4-methylpiperidine (PubChem CID 1433407) has the molecular formula C21H24FN5 and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[(S)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-phenylmethyl]-4-methylpiperidine.
| Compound Name | 1-[(S)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-phenylmethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 1433407 |
| Molecular Formula | C21H24FN5 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[(S)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-phenylmethyl]-4-methylpiperidine |
| SMILES | CC1CCN([C@@H](c2ccccc2)c2nnnn2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FN5/c1-16-11-13-26(14-12-16)20(18-5-3-2-4-6-18)21-23-24-25-27(21)15-17-7-9-19(22)10-8-17/h2-10,16,20H,11-15H2,1H3/t20-/m0/s1 |
| InChIKey | LYFMDSAICSSWSU-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |