C22H28N6 — CID 1443802
1-[(R)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-phenylpiperazine (PubChem CID 1443802) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-[(R)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-phenylpiperazine.
| Compound Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 1443802 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]-4-phenylpiperazine |
| SMILES | CC(C)(C)n1nnnc1[C@H](c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N6/c1-22(2,3)28-21(23-24-25-28)20(18-10-6-4-7-11-18)27-16-14-26(15-17-27)19-12-8-5-9-13-19/h4-13,20H,14-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | DOMNLZNKLVREQG-FQEVSTJZSA-N |
| XLogP | 3.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |