C23H29ClN6O — CID 3842641
1-[(1-tert-butyltetrazol-5-yl)-(3-methoxyphenyl)methyl]-4-(3-chlorophenyl)piperazine (PubChem CID 3842641) has the molecular formula C23H29ClN6O and a molecular weight of 440.98 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-(3-methoxyphenyl)methyl]-4-(3-chlorophenyl)piperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-(3-methoxyphenyl)methyl]-4-(3-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 3842641 |
| Molecular Formula | C23H29ClN6O |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-(3-methoxyphenyl)methyl]-4-(3-chlorophenyl)piperazine |
| SMILES | COc1cccc(C(c2nnnn2C(C)(C)C)N2CCN(c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C23H29ClN6O/c1-23(2,3)30-22(25-26-27-30)21(17-7-5-10-20(15-17)31-4)29-13-11-28(12-14-29)19-9-6-8-18(24)16-19/h5-10,15-16,21H,11-14H2,1-4H3 |
| InChIKey | BGGWENPPFYUHOM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |