C22H29N5S — CID 1431022
4-benzyl-1-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperidine (PubChem CID 1431022) has the molecular formula C22H29N5S and a molecular weight of 395.58 g/mol. Its IUPAC name is 4-benzyl-1-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperidine.
| Compound Name | 4-benzyl-1-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperidine |
|---|---|
| PubChem CID | 1431022 |
| Molecular Formula | C22H29N5S |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-benzyl-1-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperidine |
| SMILES | CC(C)(C)n1nnnc1[C@H](c1cccs1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N5S/c1-22(2,3)27-21(23-24-25-27)20(19-10-7-15-28-19)26-13-11-18(12-14-26)16-17-8-5-4-6-9-17/h4-10,15,18,20H,11-14,16H2,1-3H3/t20-/m0/s1 |
| InChIKey | NWBGKZHFVJGJGM-FQEVSTJZSA-N |
| XLogP | 4.53 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |