C15H24N6S — CID 1489640
1-[(R)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-methylpiperazine (PubChem CID 1489640) has the molecular formula C15H24N6S and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[(R)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-methylpiperazine.
| Compound Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 1489640 |
| Molecular Formula | C15H24N6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-methylpiperazine |
| SMILES | CN1CCN([C@H](c2cccs2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N6S/c1-15(2,3)21-14(16-17-18-21)13(12-6-5-11-22-12)20-9-7-19(4)8-10-20/h5-6,11,13H,7-10H2,1-4H3/t13-/m1/s1 |
| InChIKey | VROJWTBQUGXOIZ-CYBMUJFWSA-N |
| XLogP | 1.83 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |