C15H30N6 — CID 860703
1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-methylpiperazine (PubChem CID 860703) has the molecular formula C15H30N6 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-methylpiperazine.
| Compound Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 860703 |
| Molecular Formula | C15H30N6 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-methylpiperazine |
| SMILES | CC(C)C[C@@H](c1nnnn1C(C)(C)C)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H30N6/c1-12(2)11-13(20-9-7-19(6)8-10-20)14-16-17-18-21(14)15(3,4)5/h12-13H,7-11H2,1-6H3/t13-/m0/s1 |
| InChIKey | UMQSJYGTASTFRM-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |