C19H30N6O2 — CID 1443764
[4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 1443764) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 1443764 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CC(C)C[C@@H](c1nnnn1C(C)(C)C)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H30N6O2/c1-14(2)13-15(17-20-21-22-25(17)19(3,4)5)23-8-10-24(11-9-23)18(26)16-7-6-12-27-16/h6-7,12,14-15H,8-11,13H2,1-5H3/t15-/m0/s1 |
| InChIKey | WXNZCOIQJDAAGA-HNNXBMFYSA-N |
| XLogP | 2.57 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |