C18H28N6O2 — CID 7391736
furan-2-yl-[4-[(1S)-3-methyl-1-(1-propan-2-yltetrazol-5-yl)butyl]piperazin-1-yl]methanone (PubChem CID 7391736) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is furan-2-yl-[4-[(1S)-3-methyl-1-(1-propan-2-yltetrazol-5-yl)butyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(1S)-3-methyl-1-(1-propan-2-yltetrazol-5-yl)butyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7391736 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | furan-2-yl-[4-[(1S)-3-methyl-1-(1-propan-2-yltetrazol-5-yl)butyl]piperazin-1-yl]methanone |
| SMILES | CC(C)C[C@@H](c1nnnn1C(C)C)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H28N6O2/c1-13(2)12-15(17-19-20-21-24(17)14(3)4)22-7-9-23(10-8-22)18(25)16-6-5-11-26-16/h5-6,11,13-15H,7-10,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | HFRJCHREFRERKH-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |