C18H28N6O3 — CID 7391486
furan-2-yl-[4-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazin-1-yl]methanone (PubChem CID 7391486) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is furan-2-yl-[4-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7391486 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | furan-2-yl-[4-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazin-1-yl]methanone |
| SMILES | CCCC[C@H](c1nnnn1CCOC)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H28N6O3/c1-3-4-6-15(17-19-20-21-24(17)12-14-26-2)22-8-10-23(11-9-22)18(25)16-7-5-13-27-16/h5,7,13,15H,3-4,6,8-12,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | NJDHSEDUKYPWKM-OAHLLOKOSA-N |
| XLogP | 1.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |