C22H28N6O2 — CID 7396290
[4-[(1S)-1-(1-benzyltetrazol-5-yl)pentyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 7396290) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is [4-[(1S)-1-(1-benzyltetrazol-5-yl)pentyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(1S)-1-(1-benzyltetrazol-5-yl)pentyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 7396290 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [4-[(1S)-1-(1-benzyltetrazol-5-yl)pentyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCCC[C@@H](c1nnnn1Cc1ccccc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H28N6O2/c1-2-3-10-19(21-23-24-25-28(21)17-18-8-5-4-6-9-18)26-12-14-27(15-13-26)22(29)20-11-7-16-30-20/h4-9,11,16,19H,2-3,10,12-15,17H2,1H3/t19-/m0/s1 |
| InChIKey | PSLJEARVQRZIDN-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |