C24H23ClN6O2 — CID 3209704
[4-[(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3209704) has the molecular formula C24H23ClN6O2 and a molecular weight of 462.94 g/mol. Its IUPAC name is [4-[(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3209704 |
| Molecular Formula | C24H23ClN6O2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(c2ccc(Cl)cc2)c2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H23ClN6O2/c25-20-10-8-19(9-11-20)22(23-26-27-28-31(23)17-18-5-2-1-3-6-18)29-12-14-30(15-13-29)24(32)21-7-4-16-33-21/h1-11,16,22H,12-15,17H2 |
| InChIKey | GWNRIUBPBWOQGT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |