C17H27N6O2+ — CID 7383929
[4-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone (PubChem CID 7383929) has the molecular formula C17H27N6O2+ and a molecular weight of 347.44 g/mol. Its IUPAC name is [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 7383929 |
| Molecular Formula | C17H27N6O2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [4-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
| SMILES | CC[C@@H](c1nnnn1C(C)(C)C)[NH+]1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H26N6O2/c1-5-13(15-18-19-20-23(15)17(2,3)4)21-8-10-22(11-9-21)16(24)14-7-6-12-25-14/h6-7,12-13H,5,8-11H2,1-4H3/p+1/t13-/m0/s1 |
| InChIKey | UETHRKPIJZXJBP-ZDUSSCGKSA-O |
| XLogP | 0.51 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |