C23H32N7O2+ — CID 6986020
[4-[(S)-(1-tert-butyltetrazol-5-yl)-[4-(dimethylamino)phenyl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone (PubChem CID 6986020) has the molecular formula C23H32N7O2+ and a molecular weight of 438.56 g/mol. Its IUPAC name is [4-[(S)-(1-tert-butyltetrazol-5-yl)-[4-(dimethylamino)phenyl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(S)-(1-tert-butyltetrazol-5-yl)-[4-(dimethylamino)phenyl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 6986020 |
| Molecular Formula | C23H32N7O2+ |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [4-[(S)-(1-tert-butyltetrazol-5-yl)-[4-(dimethylamino)phenyl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
| SMILES | CN(C)c1ccc([C@@H](c2nnnn2C(C)(C)C)[NH+]2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H31N7O2/c1-23(2,3)30-21(24-25-26-30)20(17-8-10-18(11-9-17)27(4)5)28-12-14-29(15-13-28)22(31)19-7-6-16-32-19/h6-11,16,20H,12-15H2,1-5H3/p+1/t20-/m0/s1 |
| InChIKey | ONKSJAPCWBFMMV-FQEVSTJZSA-O |
| XLogP | 1.22 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|