C12H25ClN6 — CID 171667964
1-[1-(1-tert-butyltetrazol-5-yl)ethyl]-4-methylpiperazine;hydrochloride (PubChem CID 171667964) has the molecular formula C12H25ClN6 and a molecular weight of 288.83 g/mol. Its IUPAC name is 1-[1-(1-tert-butyltetrazol-5-yl)ethyl]-4-methylpiperazine;hydrochloride.
| Compound Name | 1-[1-(1-tert-butyltetrazol-5-yl)ethyl]-4-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171667964 |
| Molecular Formula | C12H25ClN6 |
| Molecular Weight | 288.83 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[1-(1-tert-butyltetrazol-5-yl)ethyl]-4-methylpiperazine;hydrochloride |
| SMILES | CC(c1nnnn1C(C)(C)C)N1CCN(C)CC1.Cl |
| InChI | InChI=1S/C12H24N6.ClH/c1-10(17-8-6-16(5)7-9-17)11-13-14-15-18(11)12(2,3)4;/h10H,6-9H2,1-5H3;1H |
| InChIKey | ZAXBXJVQBPMFPJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.83 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |