C18H25F3N6 — CID 1431296
1-[(1S)-1-(1-tert-butyltetrazol-5-yl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 1431296) has the molecular formula C18H25F3N6 and a molecular weight of 382.43 g/mol. Its IUPAC name is 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 1431296 |
| Molecular Formula | C18H25F3N6 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | C[C@@H](c1nnnn1C(C)(C)C)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H25F3N6/c1-13(16-22-23-24-27(16)17(2,3)4)25-8-10-26(11-9-25)15-7-5-6-14(12-15)18(19,20)21/h5-7,12-13H,8-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | VWDWBRHDBSZNLW-ZDUSSCGKSA-N |
| XLogP | 3.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |