C15H19F3N6 — CID 99828945
1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-[4-(trifluoromethyl)phenyl]piperazine (PubChem CID 99828945) has the molecular formula C15H19F3N6 and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-[4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-[4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 99828945 |
| Molecular Formula | C15H19F3N6 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-[4-(trifluoromethyl)phenyl]piperazine |
| SMILES | C[C@@H](c1nnnn1C)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H19F3N6/c1-11(14-19-20-21-22(14)2)23-7-9-24(10-8-23)13-5-3-12(4-6-13)15(16,17)18/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | RABXVQHLJZGJOB-NSHDSACASA-N |
| XLogP | 2.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |