C13H16F3NO — CID 112627963
1-[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethanol (PubChem CID 112627963) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 112627963 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethanol |
| SMILES | CC(O)C1CCN(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C13H16F3NO/c1-9(18)10-6-7-17(8-10)12-4-2-11(3-5-12)13(14,15)16/h2-5,9-10,18H,6-8H2,1H3 |
| InChIKey | SGLSXSSZDANQHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |