C14H17F3N2O2 — CID 97337783
(2S)-2-hydroxy-N-[(3S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]propanamide (PubChem CID 97337783) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(3S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]propanamide.
| Compound Name | (2S)-2-hydroxy-N-[(3S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 97337783 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2S)-2-hydroxy-N-[(3S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]propanamide |
| SMILES | C[C@H](O)C(=O)N[C@H]1CCN(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-9(20)13(21)18-11-6-7-19(8-11)12-4-2-10(3-5-12)14(15,16)17/h2-5,9,11,20H,6-8H2,1H3,(H,18,21)/t9-,11-/m0/s1 |
| InChIKey | IGOZVJMXCVWRBW-ONGXEEELSA-N |
| XLogP | 1.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |