C27H30F3N3O3 — CID 159119575
N-[(3R)-1-[4-[(3S)-2-oxo-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-1-yl]phenyl]pyrrolidin-3-yl]acetamide (PubChem CID 159119575) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-[(3R)-1-[4-[(3S)-2-oxo-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-1-yl]phenyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[(3R)-1-[4-[(3S)-2-oxo-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-1-yl]phenyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 159119575 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[(3R)-1-[4-[(3S)-2-oxo-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-1-yl]phenyl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCN(c2ccc(N3CCC[C@@H](CC(=O)Cc4ccc(C(F)(F)F)cc4)C3=O)cc2)C1 |
| InChI | InChI=1S/C27H30F3N3O3/c1-18(34)31-22-12-14-32(17-22)23-8-10-24(11-9-23)33-13-2-3-20(26(33)36)16-25(35)15-19-4-6-21(7-5-19)27(28,29)30/h4-11,20,22H,2-3,12-17H2,1H3,(H,31,34)/t20-,22+/m0/s1 |
| InChIKey | KFNDFBBROHPGBZ-RBBKRZOGSA-N |
| XLogP | 4.37 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|