C23H28F3N5O — CID 146302608
2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide (PubChem CID 146302608) has the molecular formula C23H28F3N5O and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 146302608 |
| Molecular Formula | C23H28F3N5O |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
| SMILES | CN1CCN(c2ccc(CC(=O)N[C@@H]3CCN(c4cncc(C(F)(F)F)c4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H28F3N5O/c1-29-8-10-30(11-9-29)20-4-2-17(3-5-20)12-22(32)28-19-6-7-31(16-19)21-13-18(14-27-15-21)23(24,25)26/h2-5,13-15,19H,6-12,16H2,1H3,(H,28,32)/t19-/m1/s1 |
| InChIKey | IOIUFCRHMXKKJO-LJQANCHMSA-N |
| XLogP | 2.79 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|