C14H19F3N4O — CID 146302811
2-(dimethylamino)-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide (PubChem CID 146302811) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 146302811 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-(dimethylamino)-N-[(3R)-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
| SMILES | CN(C)CC(=O)N[C@@H]1CCN(c2cncc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H19F3N4O/c1-20(2)9-13(22)19-11-3-4-21(8-11)12-5-10(6-18-7-12)14(15,16)17/h5-7,11H,3-4,8-9H2,1-2H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | PMLCGRSEAJPVCQ-LLVKDONJSA-N |
| XLogP | 1.36 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |