C13H13ClF3N3O — CID 154865404
N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 154865404) has the molecular formula C13H13ClF3N3O and a molecular weight of 319.71 g/mol. Its IUPAC name is N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154865404 |
| Molecular Formula | C13H13ClF3N3O |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C13H13ClF3N3O/c1-2-11(21)19-9-3-4-20(7-9)12-10(14)5-8(6-18-12)13(15,16)17/h2,5-6,9H,1,3-4,7H2,(H,19,21) |
| InChIKey | CYBDVOBQPZNPLA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|