C10H12Cl2F3N3 — CID 71643949
(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 71643949) has the molecular formula C10H12Cl2F3N3 and a molecular weight of 302.13 g/mol. Its IUPAC name is (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71643949 |
| Molecular Formula | C10H12Cl2F3N3 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C10H11ClF3N3.ClH/c11-8-3-6(10(12,13)14)4-16-9(8)17-2-1-7(15)5-17;/h3-4,7H,1-2,5,15H2;1H/t7-;/m0./s1 |
| InChIKey | VVGDIAITSWOAJC-FJXQXJEOSA-N |
| XLogP | 2.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |