C11H12ClF3N2O — CID 55064792
[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanol (PubChem CID 55064792) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 55064792 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C11H12ClF3N2O/c12-9-3-8(11(13,14)15)4-16-10(9)17-2-1-7(5-17)6-18/h3-4,7,18H,1-2,5-6H2 |
| InChIKey | LDDMOZQHOGVMNG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |