C11H10ClF3N2O2 — CID 64616049
2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]acetic acid (PubChem CID 64616049) has the molecular formula C11H10ClF3N2O2 and a molecular weight of 294.66 g/mol. Its IUPAC name is 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64616049 |
| Molecular Formula | C11H10ClF3N2O2 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C11H10ClF3N2O2/c12-8-2-7(11(13,14)15)3-16-10(8)17-4-6(5-17)1-9(18)19/h2-3,6H,1,4-5H2,(H,18,19) |
| InChIKey | KAWSSVGGWCGWOV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |