C11H12ClF3N4O — CID 1486166
4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 1486166) has the molecular formula C11H12ClF3N4O and a molecular weight of 308.69 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 1486166 |
| Molecular Formula | C11H12ClF3N4O |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C11H12ClF3N4O/c12-8-5-7(11(13,14)15)6-17-9(8)18-1-3-19(4-2-18)10(16)20/h5-6H,1-4H2,(H2,16,20) |
| InChIKey | XHPUMUDCOHXVML-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |