C17H18Cl3F3N4O — CID 119946107
(2-aminophenyl)-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119946107) has the molecular formula C17H18Cl3F3N4O and a molecular weight of 457.71 g/mol. Its IUPAC name is (2-aminophenyl)-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119946107 |
| Molecular Formula | C17H18Cl3F3N4O |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (2-aminophenyl)-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H16ClF3N4O.2ClH/c18-13-9-11(17(19,20)21)10-23-15(13)24-5-7-25(8-6-24)16(26)12-3-1-2-4-14(12)22;;/h1-4,9-10H,5-8,22H2;2*1H |
| InChIKey | XFYDVWYERHRBJY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|