C14H13Cl3F3N3O — CID 78781777
[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(2,2-dichlorocyclopropyl)methanone (PubChem CID 78781777) has the molecular formula C14H13Cl3F3N3O and a molecular weight of 402.63 g/mol. Its IUPAC name is [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(2,2-dichlorocyclopropyl)methanone.
| Compound Name | [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(2,2-dichlorocyclopropyl)methanone |
|---|---|
| PubChem CID | 78781777 |
| Molecular Formula | C14H13Cl3F3N3O |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(2,2-dichlorocyclopropyl)methanone |
| SMILES | O=C(C1CC1(Cl)Cl)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H13Cl3F3N3O/c15-10-5-8(14(18,19)20)7-21-11(10)22-1-3-23(4-2-22)12(24)9-6-13(9,16)17/h5,7,9H,1-4,6H2 |
| InChIKey | QEBHPHJNIGLJQP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|