C17H13Cl2F6N5O — CID 135822331
(NZ)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methylidene]hydroxylamine (PubChem CID 135822331) has the molecular formula C17H13Cl2F6N5O and a molecular weight of 488.22 g/mol. Its IUPAC name is (NZ)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135822331 |
| Molecular Formula | C17H13Cl2F6N5O |
| Molecular Weight | 488.22 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (NZ)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methylidene]hydroxylamine |
| SMILES | O/N=C(/c1ncc(C(F)(F)F)cc1Cl)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H13Cl2F6N5O/c18-11-5-9(16(20,21)22)7-26-13(11)15(28-31)30-3-1-29(2-4-30)14-12(19)6-10(8-27-14)17(23,24)25/h5-8,31H,1-4H2/b28-15- |
| InChIKey | WZNOMPBZYBJSKW-MBTHVWNTSA-N |
| XLogP | 4.78 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|