C10H12F3N5O — CID 129105303
4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxamide (PubChem CID 129105303) has the molecular formula C10H12F3N5O and a molecular weight of 275.23 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129105303 |
| Molecular Formula | C10H12F3N5O |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C10H12F3N5O/c11-10(12,13)7-5-15-9(16-6-7)18-3-1-17(2-4-18)8(14)19/h5-6H,1-4H2,(H2,14,19) |
| InChIKey | RVMZTKMDORUSAG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |