C10H11F3N4O2 — CID 171778967
4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid (PubChem CID 171778967) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 171778967 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C10H11F3N4O2/c11-10(12,13)7-5-14-8(15-6-7)16-1-3-17(4-2-16)9(18)19/h5-6H,1-4H2,(H,18,19) |
| InChIKey | LTACIKTVCZFIBU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |