C12H15F3N4O2 — CID 174238663
(3S)-3-ethyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid (PubChem CID 174238663) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is (3S)-3-ethyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | (3S)-3-ethyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174238663 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3S)-3-ethyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
| SMILES | CC[C@H]1CN(C(=O)O)CCN1c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H15F3N4O2/c1-2-9-7-18(11(20)21)3-4-19(9)10-16-5-8(6-17-10)12(13,14)15/h5-6,9H,2-4,7H2,1H3,(H,20,21)/t9-/m0/s1 |
| InChIKey | UFKSPSDUXRJUOA-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |