C14H15F3IN3O4 — CID 170428678
(3R)-3-(acetyloxymethyl)-4-[4-iodo-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 170428678) has the molecular formula C14H15F3IN3O4 and a molecular weight of 473.19 g/mol. Its IUPAC name is (3R)-3-(acetyloxymethyl)-4-[4-iodo-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-(acetyloxymethyl)-4-[4-iodo-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170428678 |
| Molecular Formula | C14H15F3IN3O4 |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | (3R)-3-(acetyloxymethyl)-4-[4-iodo-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | CC(=O)OC[C@H]1CN(C(=O)O)CCN1c1cc(I)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H15F3IN3O4/c1-8(22)25-7-9-6-20(13(23)24)2-3-21(9)12-4-11(18)10(5-19-12)14(15,16)17/h4-5,9H,2-3,6-7H2,1H3,(H,23,24)/t9-/m1/s1 |
| InChIKey | UZNAETQGFDWELW-SECBINFHSA-N |
| XLogP | 2.44 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|