C14H18F3N3O4 — CID 155272504
4-[6-(2-methoxyethoxy)-5-(trifluoromethyl)-3-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 155272504) has the molecular formula C14H18F3N3O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is 4-[6-(2-methoxyethoxy)-5-(trifluoromethyl)-3-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-(2-methoxyethoxy)-5-(trifluoromethyl)-3-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 155272504 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[6-(2-methoxyethoxy)-5-(trifluoromethyl)-3-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | COCCOc1ncc(N2CCN(C(=O)O)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O4/c1-23-6-7-24-12-11(14(15,16)17)8-10(9-18-12)19-2-4-20(5-3-19)13(21)22/h8-9H,2-7H2,1H3,(H,21,22) |
| InChIKey | UHQIZCSSLQSTIN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|