C15H17F3N2O4 — CID 151465294
4-[4-ethoxycarbonyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 151465294) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-[4-ethoxycarbonyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-ethoxycarbonyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 151465294 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[4-ethoxycarbonyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)O)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O4/c1-2-24-13(21)10-3-4-12(11(9-10)15(16,17)18)19-5-7-20(8-6-19)14(22)23/h3-4,9H,2,5-8H2,1H3,(H,22,23) |
| InChIKey | PJHURWOQCIBLND-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |